C14H24O4 — CID 135038065
[(2S,3R,4S)-3-hydroxy-4-methylhex-5-en-2-yl] (2R,3R)-3-hydroxy-2,4-dimethylpent-4-enoate (PubChem CID 135038065) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is [(2S,3R,4S)-3-hydroxy-4-methylhex-5-en-2-yl] (2R,3R)-3-hydroxy-2,4-dimethylpent-4-enoate.
| Compound Name | [(2S,3R,4S)-3-hydroxy-4-methylhex-5-en-2-yl] (2R,3R)-3-hydroxy-2,4-dimethylpent-4-enoate |
|---|---|
| PubChem CID | 135038065 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | [(2S,3R,4S)-3-hydroxy-4-methylhex-5-en-2-yl] (2R,3R)-3-hydroxy-2,4-dimethylpent-4-enoate |
| SMILES | C=C[C@H](C)[C@@H](O)[C@H](C)OC(=O)[C@H](C)[C@@H](O)C(=C)C |
| InChI | InChI=1S/C14H24O4/c1-7-9(4)13(16)11(6)18-14(17)10(5)12(15)8(2)3/h7,9-13,15-16H,1-2H2,3-6H3/t9-,10+,11-,12-,13+/m0/s1 |
| InChIKey | ODBDPIMUPXRWDB-FPYNETTCSA-N |
| XLogP | 1.67 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|