C12H20O4 — CID 135038038
(2S,3R,4S,5E,7R,8R)-3,7-dihydroxy-2,4,6,8-tetramethyl-3,4,7,8-tetrahydro-2H-oxonin-9-one (PubChem CID 135038038) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is (2S,3R,4S,5E,7R,8R)-3,7-dihydroxy-2,4,6,8-tetramethyl-3,4,7,8-tetrahydro-2H-oxonin-9-one.
| Compound Name | (2S,3R,4S,5E,7R,8R)-3,7-dihydroxy-2,4,6,8-tetramethyl-3,4,7,8-tetrahydro-2H-oxonin-9-one |
|---|---|
| PubChem CID | 135038038 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (2S,3R,4S,5E,7R,8R)-3,7-dihydroxy-2,4,6,8-tetramethyl-3,4,7,8-tetrahydro-2H-oxonin-9-one |
| SMILES | C/C1=C\[C@H](C)[C@@H](O)[C@H](C)OC(=O)[C@H](C)[C@H]1O |
| InChI | InChI=1S/C12H20O4/c1-6-5-7(2)11(14)9(4)16-12(15)8(3)10(6)13/h5,7-11,13-14H,1-4H3/b6-5+/t7-,8+,9-,10-,11+/m0/s1 |
| InChIKey | JCKWIERLVAHTNE-XNYKMCEVSA-N |
| XLogP | 0.87 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|