C14H22O2 — CID 135038616
methyl (2S,3R,3aR,6aR)-3,3a,6,6a-tetramethyl-1,2,3,4-tetrahydropentalene-2-carboxylate (PubChem CID 135038616) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is methyl (2S,3R,3aR,6aR)-3,3a,6,6a-tetramethyl-1,2,3,4-tetrahydropentalene-2-carboxylate.
| Compound Name | methyl (2S,3R,3aR,6aR)-3,3a,6,6a-tetramethyl-1,2,3,4-tetrahydropentalene-2-carboxylate |
|---|---|
| PubChem CID | 135038616 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | methyl (2S,3R,3aR,6aR)-3,3a,6,6a-tetramethyl-1,2,3,4-tetrahydropentalene-2-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@]2(C)C(C)=CC[C@]2(C)[C@@H]1C |
| InChI | InChI=1S/C14H22O2/c1-9-6-7-13(3)10(2)11(12(15)16-5)8-14(9,13)4/h6,10-11H,7-8H2,1-5H3/t10-,11+,13-,14-/m1/s1 |
| InChIKey | DSGCISHAQCNVPN-ZMJPVWNMSA-N |
| XLogP | 3.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|