C12H20O5 — CID 135038624
2-[2-(4-methyl-5-oxohexyl)-1,3-dioxolan-2-yl]acetic acid (PubChem CID 135038624) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-[2-(4-methyl-5-oxohexyl)-1,3-dioxolan-2-yl]acetic acid.
| Compound Name | 2-[2-(4-methyl-5-oxohexyl)-1,3-dioxolan-2-yl]acetic acid |
|---|---|
| PubChem CID | 135038624 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 2-[2-(4-methyl-5-oxohexyl)-1,3-dioxolan-2-yl]acetic acid |
| SMILES | CC(=O)C(C)CCCC1(CC(=O)O)OCCO1 |
| InChI | InChI=1S/C12H20O5/c1-9(10(2)13)4-3-5-12(8-11(14)15)16-6-7-17-12/h9H,3-8H2,1-2H3,(H,14,15) |
| InChIKey | QPDYANXPCVAHLP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |