C14H22O3 — CID 135038726
methyl (1S,2S,3aR,4R,6aR)-1,3a,4,6a-tetramethyl-5-oxo-2,3,4,6-tetrahydro-1H-pentalene-2-carboxylate (PubChem CID 135038726) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is methyl (1S,2S,3aR,4R,6aR)-1,3a,4,6a-tetramethyl-5-oxo-2,3,4,6-tetrahydro-1H-pentalene-2-carboxylate.
| Compound Name | methyl (1S,2S,3aR,4R,6aR)-1,3a,4,6a-tetramethyl-5-oxo-2,3,4,6-tetrahydro-1H-pentalene-2-carboxylate |
|---|---|
| PubChem CID | 135038726 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | methyl (1S,2S,3aR,4R,6aR)-1,3a,4,6a-tetramethyl-5-oxo-2,3,4,6-tetrahydro-1H-pentalene-2-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@]2(C)[C@@H](C)C(=O)C[C@]2(C)[C@H]1C |
| InChI | InChI=1S/C14H22O3/c1-8-10(12(16)17-5)6-13(3)9(2)11(15)7-14(8,13)4/h8-10H,6-7H2,1-5H3/t8-,9-,10-,13+,14+/m0/s1 |
| InChIKey | GYQMKHMSAGMADC-HAOVPJPFSA-N |
| XLogP | 2.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |