C9H16O4 — CID 135038757
(1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylidenepropane-1,3-diol (PubChem CID 135038757) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is (1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylidenepropane-1,3-diol.
| Compound Name | (1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylidenepropane-1,3-diol |
|---|---|
| PubChem CID | 135038757 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | (1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylidenepropane-1,3-diol |
| SMILES | C=C(CO)[C@H](O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C9H16O4/c1-6(4-10)8(11)7-5-12-9(2,3)13-7/h7-8,10-11H,1,4-5H2,2-3H3/t7-,8+/m1/s1 |
| InChIKey | PAFLHEUYHFILCE-SFYZADRCSA-N |
| XLogP | 0.05 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|