C12H19NO3 — CID 135039108
[(2Z)-2-hydroxyimino-2-[(4R)-4,5,5-trimethylcyclopenten-1-yl]ethyl] acetate (PubChem CID 135039108) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is [(2Z)-2-hydroxyimino-2-[(4R)-4,5,5-trimethylcyclopenten-1-yl]ethyl] acetate.
| Compound Name | [(2Z)-2-hydroxyimino-2-[(4R)-4,5,5-trimethylcyclopenten-1-yl]ethyl] acetate |
|---|---|
| PubChem CID | 135039108 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | [(2Z)-2-hydroxyimino-2-[(4R)-4,5,5-trimethylcyclopenten-1-yl]ethyl] acetate |
| SMILES | CC(=O)OC/C(=N\O)C1=CC[C@@H](C)C1(C)C |
| InChI | InChI=1S/C12H19NO3/c1-8-5-6-10(12(8,3)4)11(13-15)7-16-9(2)14/h6,8,15H,5,7H2,1-4H3/b13-11+/t8-/m1/s1 |
| InChIKey | OXIWZOVLGYWRGV-DJTJNUHNSA-N |
| XLogP | 2.37 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|