C15H22O3 — CID 135039279
1',9'-dimethylspiro[1,3-dioxolane-2,11'-tricyclo[5.2.2.02,6]undec-8-ene]-4'-ol (PubChem CID 135039279) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1',9'-dimethylspiro[1,3-dioxolane-2,11'-tricyclo[5.2.2.02,6]undec-8-ene]-4'-ol.
| Compound Name | 1',9'-dimethylspiro[1,3-dioxolane-2,11'-tricyclo[5.2.2.02,6]undec-8-ene]-4'-ol |
|---|---|
| PubChem CID | 135039279 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 1',9'-dimethylspiro[1,3-dioxolane-2,11'-tricyclo[5.2.2.02,6]undec-8-ene]-4'-ol |
| SMILES | CC1=CC2C3CC(O)CC3C1(C)CC21OCCO1 |
| InChI | InChI=1S/C15H22O3/c1-9-5-13-11-6-10(16)7-12(11)14(9,2)8-15(13)17-3-4-18-15/h5,10-13,16H,3-4,6-8H2,1-2H3 |
| InChIKey | GYDQPJIJTDDCGZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|