C7H8F5NO3 — CID 135039672
1-(4,4-difluoro-3,3-dihydroxypiperidin-1-yl)-2,2,2-trifluoroethanone (PubChem CID 135039672) has the molecular formula C7H8F5NO3 and a molecular weight of 249.13 g/mol. Its IUPAC name is 1-(4,4-difluoro-3,3-dihydroxypiperidin-1-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(4,4-difluoro-3,3-dihydroxypiperidin-1-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 135039672 |
| Molecular Formula | C7H8F5NO3 |
| Molecular Weight | 249.13 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 1-(4,4-difluoro-3,3-dihydroxypiperidin-1-yl)-2,2,2-trifluoroethanone |
| SMILES | O=C(N1CCC(F)(F)C(O)(O)C1)C(F)(F)F |
| InChI | InChI=1S/C7H8F5NO3/c8-5(9)1-2-13(3-6(5,15)16)4(14)7(10,11)12/h15-16H,1-3H2 |
| InChIKey | HGYKPKVLPORHKK-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.13 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|