C9H10F3NO3 — CID 167741034
3-ethenyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid (PubChem CID 167741034) has the molecular formula C9H10F3NO3 and a molecular weight of 237.18 g/mol. Its IUPAC name is 3-ethenyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 3-ethenyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 167741034 |
| Molecular Formula | C9H10F3NO3 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 3-ethenyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid |
| SMILES | C=CC1(C(=O)O)CCN(C(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C9H10F3NO3/c1-2-8(7(15)16)3-4-13(5-8)6(14)9(10,11)12/h2H,1,3-5H2,(H,15,16) |
| InChIKey | OTQBIUWEDYXNJO-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|