C7H6BrN3S — CID 135039838
3-bromo-1-methyl-5-thiophen-2-yl-1,2,4-triazole (PubChem CID 135039838) has the molecular formula C7H6BrN3S and a molecular weight of 244.12 g/mol. Its IUPAC name is 3-bromo-1-methyl-5-thiophen-2-yl-1,2,4-triazole.
| Compound Name | 3-bromo-1-methyl-5-thiophen-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 135039838 |
| Molecular Formula | C7H6BrN3S |
| Molecular Weight | 244.12 g/mol |
| Exact Mass | 242.95 |
| IUPAC Name | 3-bromo-1-methyl-5-thiophen-2-yl-1,2,4-triazole |
| SMILES | Cn1nc(Br)nc1-c1cccs1 |
| InChI | InChI=1S/C7H6BrN3S/c1-11-6(9-7(8)10-11)5-3-2-4-12-5/h2-4H,1H3 |
| InChIKey | XGIIAVLOZYZGCA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.12 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |