C13H12N4S — CID 62733759
4-(2-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)aniline (PubChem CID 62733759) has the molecular formula C13H12N4S and a molecular weight of 256.33 g/mol. Its IUPAC name is 4-(2-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)aniline.
| Compound Name | 4-(2-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)aniline |
|---|---|
| PubChem CID | 62733759 |
| Molecular Formula | C13H12N4S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 4-(2-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)aniline |
| SMILES | Cn1nc(-c2cccs2)nc1-c1ccc(N)cc1 |
| InChI | InChI=1S/C13H12N4S/c1-17-13(9-4-6-10(14)7-5-9)15-12(16-17)11-3-2-8-18-11/h2-8H,14H2,1H3 |
| InChIKey | UGEDLKMEAMTISQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|