C11H20O4 — CID 135039893
ethyl (E,5S)-5-(methoxymethoxy)hept-2-enoate (PubChem CID 135039893) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is ethyl (E,5S)-5-(methoxymethoxy)hept-2-enoate.
| Compound Name | ethyl (E,5S)-5-(methoxymethoxy)hept-2-enoate |
|---|---|
| PubChem CID | 135039893 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | ethyl (E,5S)-5-(methoxymethoxy)hept-2-enoate |
| SMILES | CCOC(=O)/C=C/C[C@H](CC)OCOC |
| InChI | InChI=1S/C11H20O4/c1-4-10(15-9-13-3)7-6-8-11(12)14-5-2/h6,8,10H,4-5,7,9H2,1-3H3/b8-6+/t10-/m0/s1 |
| InChIKey | OTWHKPZFEBTONE-PCGIRMHASA-N |
| XLogP | 1.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|