C10H18O4S — CID 135039988
ethyl (5S)-5-[(2S)-2-methylbutyl]-1,3,2-dioxathiolane-4-carboxylate (PubChem CID 135039988) has the molecular formula C10H18O4S and a molecular weight of 234.32 g/mol. Its IUPAC name is ethyl (5S)-5-[(2S)-2-methylbutyl]-1,3,2-dioxathiolane-4-carboxylate.
| Compound Name | ethyl (5S)-5-[(2S)-2-methylbutyl]-1,3,2-dioxathiolane-4-carboxylate |
|---|---|
| PubChem CID | 135039988 |
| Molecular Formula | C10H18O4S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | ethyl (5S)-5-[(2S)-2-methylbutyl]-1,3,2-dioxathiolane-4-carboxylate |
| SMILES | CCOC(=O)C1OSO[C@H]1C[C@@H](C)CC |
| InChI | InChI=1S/C10H18O4S/c1-4-7(3)6-8-9(14-15-13-8)10(11)12-5-2/h7-9H,4-6H2,1-3H3/t7-,8-,9?/m0/s1 |
| InChIKey | PLDWFFZOSQJOIV-JVIMKECRSA-N |
| XLogP | 2.33 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|