C14H24O4 — CID 134898117
4-[(2R,3R)-2-methyl-4-oxooxolan-3-yl]butyl 2,2-dimethylpropanoate (PubChem CID 134898117) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is 4-[(2R,3R)-2-methyl-4-oxooxolan-3-yl]butyl 2,2-dimethylpropanoate.
| Compound Name | 4-[(2R,3R)-2-methyl-4-oxooxolan-3-yl]butyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134898117 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 4-[(2R,3R)-2-methyl-4-oxooxolan-3-yl]butyl 2,2-dimethylpropanoate |
| SMILES | C[C@H]1OCC(=O)[C@@H]1CCCCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C14H24O4/c1-10-11(12(15)9-18-10)7-5-6-8-17-13(16)14(2,3)4/h10-11H,5-9H2,1-4H3/t10-,11-/m1/s1 |
| InChIKey | ZGHRSJXVAGJBAU-GHMZBOCLSA-N |
| XLogP | 2.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|