C17H22O2 — CID 135040355
(2R)-2-methyl-2-[(1S)-1-methylcyclohex-2-en-1-yl]-3-phenylpropanoic acid (PubChem CID 135040355) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is (2R)-2-methyl-2-[(1S)-1-methylcyclohex-2-en-1-yl]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-methyl-2-[(1S)-1-methylcyclohex-2-en-1-yl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 135040355 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | (2R)-2-methyl-2-[(1S)-1-methylcyclohex-2-en-1-yl]-3-phenylpropanoic acid |
| SMILES | C[C@](Cc1ccccc1)(C(=O)O)[C@]1(C)C=CCCC1 |
| InChI | InChI=1S/C17H22O2/c1-16(11-7-4-8-12-16)17(2,15(18)19)13-14-9-5-3-6-10-14/h3,5-7,9-11H,4,8,12-13H2,1-2H3,(H,18,19)/t16-,17+/m1/s1 |
| InChIKey | RRNWMTJGGOURSA-SJORKVTESA-N |
| XLogP | 4.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|