C7H14O3 — CID 135040575
5,5,5-trideuterio-4-hydroperoxy-4-methyl-3-methylidenepentan-2-ol (PubChem CID 135040575) has the molecular formula C7H14O3 and a molecular weight of 149.20 g/mol. Its IUPAC name is 5,5,5-trideuterio-4-hydroperoxy-4-methyl-3-methylidenepentan-2-ol.
| Compound Name | 5,5,5-trideuterio-4-hydroperoxy-4-methyl-3-methylidenepentan-2-ol |
|---|---|
| PubChem CID | 135040575 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.11 |
| IUPAC Name | 5,5,5-trideuterio-4-hydroperoxy-4-methyl-3-methylidenepentan-2-ol |
| SMILES | [2H]C([2H])([2H])C(C)(OO)C(=C)C(C)O |
| InChI | InChI=1S/C7H14O3/c1-5(6(2)8)7(3,4)10-9/h6,8-9H,1H2,2-4H3/i3D3 |
| InChIKey | KZQMLYXCVJXXRO-HPRDVNIFSA-N |
| XLogP | 1.19 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|