C8H17N3 — CID 135040888
[(3R,3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-3-yl]methanamine (PubChem CID 135040888) has the molecular formula C8H17N3 and a molecular weight of 155.24 g/mol. Its IUPAC name is [(3R,3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-3-yl]methanamine.
| Compound Name | [(3R,3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-3-yl]methanamine |
|---|---|
| PubChem CID | 135040888 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | [(3R,3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-3-yl]methanamine |
| SMILES | CN1C[C@@H]2CN[C@@H](CN)[C@@H]2C1 |
| InChI | InChI=1S/C8H17N3/c1-11-4-6-3-10-8(2-9)7(6)5-11/h6-8,10H,2-5,9H2,1H3/t6-,7+,8-/m0/s1 |
| InChIKey | VIRAISKBGYQFPV-RNJXMRFFSA-N |
| XLogP | -0.91 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |