C14H20O6 — CID 135041246
diethyl 2-[(1R,4S)-4-methoxycarbonylcyclobut-2-en-1-yl]-2-methylpropanedioate (PubChem CID 135041246) has the molecular formula C14H20O6 and a molecular weight of 284.31 g/mol. Its IUPAC name is diethyl 2-[(1R,4S)-4-methoxycarbonylcyclobut-2-en-1-yl]-2-methylpropanedioate.
| Compound Name | diethyl 2-[(1R,4S)-4-methoxycarbonylcyclobut-2-en-1-yl]-2-methylpropanedioate |
|---|---|
| PubChem CID | 135041246 |
| Molecular Formula | C14H20O6 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | diethyl 2-[(1R,4S)-4-methoxycarbonylcyclobut-2-en-1-yl]-2-methylpropanedioate |
| SMILES | CCOC(=O)C(C)(C(=O)OCC)[C@@H]1C=C[C@@H]1C(=O)OC |
| InChI | InChI=1S/C14H20O6/c1-5-19-12(16)14(3,13(17)20-6-2)10-8-7-9(10)11(15)18-4/h7-10H,5-6H2,1-4H3/t9-,10+/m0/s1 |
| InChIKey | XHGPDJIMECLONE-VHSXEESVSA-N |
| XLogP | 1.09 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|