C8H12N4O2 — CID 135041491
N,N-dimethyl-N'-(3-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methanimidamide (PubChem CID 135041491) has the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. Its IUPAC name is N,N-dimethyl-N'-(3-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methanimidamide.
| Compound Name | N,N-dimethyl-N'-(3-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methanimidamide |
|---|---|
| PubChem CID | 135041491 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | N,N-dimethyl-N'-(3-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methanimidamide |
| SMILES | CN(C)/C=N/c1cc(=O)n(C)c(=O)[nH]1 |
| InChI | InChI=1S/C8H12N4O2/c1-11(2)5-9-6-4-7(13)12(3)8(14)10-6/h4-5H,1-3H3,(H,10,14)/b9-5+ |
| InChIKey | HMUQIDZOZBBAPT-WEVVVXLNSA-N |
| XLogP | -0.70 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|