C13H27NO2Si — CID 135042131
(5R)-5-[(2S)-2-[tert-butyl(dimethyl)silyl]oxypropyl]pyrrolidin-2-one (PubChem CID 135042131) has the molecular formula C13H27NO2Si and a molecular weight of 257.45 g/mol. Its IUPAC name is (5R)-5-[(2S)-2-[tert-butyl(dimethyl)silyl]oxypropyl]pyrrolidin-2-one.
| Compound Name | (5R)-5-[(2S)-2-[tert-butyl(dimethyl)silyl]oxypropyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 135042131 |
| Molecular Formula | C13H27NO2Si |
| Molecular Weight | 257.45 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | (5R)-5-[(2S)-2-[tert-butyl(dimethyl)silyl]oxypropyl]pyrrolidin-2-one |
| SMILES | C[C@@H](C[C@H]1CCC(=O)N1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H27NO2Si/c1-10(9-11-7-8-12(15)14-11)16-17(5,6)13(2,3)4/h10-11H,7-9H2,1-6H3,(H,14,15)/t10-,11+/m0/s1 |
| InChIKey | VGBYTOZANGEQPE-WDEREUQCSA-N |
| XLogP | 3.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|