C15H20O3 — CID 135042500
[(6S,7R)-6-ethyl-5-oxo-1,2,3,4,6,7-hexahydrobenzo[7]annulen-7-yl] acetate (PubChem CID 135042500) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is [(6S,7R)-6-ethyl-5-oxo-1,2,3,4,6,7-hexahydrobenzo[7]annulen-7-yl] acetate.
| Compound Name | [(6S,7R)-6-ethyl-5-oxo-1,2,3,4,6,7-hexahydrobenzo[7]annulen-7-yl] acetate |
|---|---|
| PubChem CID | 135042500 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | [(6S,7R)-6-ethyl-5-oxo-1,2,3,4,6,7-hexahydrobenzo[7]annulen-7-yl] acetate |
| SMILES | CC[C@@H]1C(=O)C2=C(C=C[C@H]1OC(C)=O)CCCC2 |
| InChI | InChI=1S/C15H20O3/c1-3-12-14(18-10(2)16)9-8-11-6-4-5-7-13(11)15(12)17/h8-9,12,14H,3-7H2,1-2H3/t12-,14+/m0/s1 |
| InChIKey | MMKGVDBCAAWLFI-GXTWGEPZSA-N |
| XLogP | 2.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |