C14H26O5Si — CID 135042828
tert-butyl-[(8-hydroperoxy-1,4-dioxaspiro[4.5]dec-6-en-8-yl)oxy]-dimethylsilane (PubChem CID 135042828) has the molecular formula C14H26O5Si and a molecular weight of 302.44 g/mol. Its IUPAC name is tert-butyl-[(8-hydroperoxy-1,4-dioxaspiro[4.5]dec-6-en-8-yl)oxy]-dimethylsilane.
| Compound Name | tert-butyl-[(8-hydroperoxy-1,4-dioxaspiro[4.5]dec-6-en-8-yl)oxy]-dimethylsilane |
|---|---|
| PubChem CID | 135042828 |
| Molecular Formula | C14H26O5Si |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | tert-butyl-[(8-hydroperoxy-1,4-dioxaspiro[4.5]dec-6-en-8-yl)oxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1(OO)C=CC2(CC1)OCCO2 |
| InChI | InChI=1S/C14H26O5Si/c1-12(2,3)20(4,5)19-14(18-15)8-6-13(7-9-14)16-10-11-17-13/h6,8,15H,7,9-11H2,1-5H3 |
| InChIKey | BHWZSJOGLABRTC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|