C15H28O3Si — CID 11448993
[(3aR,4R,7aR)-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11448993) has the molecular formula C15H28O3Si and a molecular weight of 284.47 g/mol. Its IUPAC name is [(3aR,4R,7aR)-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,4R,7aR)-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11448993 |
| Molecular Formula | C15H28O3Si |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | [(3aR,4R,7aR)-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)O[C@@H]2[C@@H](C=CC[C@H]2O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C15H28O3Si/c1-14(2,3)19(6,7)18-12-10-8-9-11-13(12)17-15(4,5)16-11/h8-9,11-13H,10H2,1-7H3/t11-,12-,13-/m1/s1 |
| InChIKey | QIAISCDDPWQQIU-JHJVBQTASA-N |
| XLogP | 3.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|