C14H8N2Se — CID 135043076
4-(1,3-benzoselenazol-2-yl)benzonitrile (PubChem CID 135043076) has the molecular formula C14H8N2Se and a molecular weight of 283.19 g/mol. Its IUPAC name is 4-(1,3-benzoselenazol-2-yl)benzonitrile.
| Compound Name | 4-(1,3-benzoselenazol-2-yl)benzonitrile |
|---|---|
| PubChem CID | 135043076 |
| Molecular Formula | C14H8N2Se |
| Molecular Weight | 283.19 g/mol |
| Exact Mass | 283.99 |
| IUPAC Name | 4-(1,3-benzoselenazol-2-yl)benzonitrile |
| SMILES | N#Cc1ccc(-c2nc3ccccc3[se]2)cc1 |
| InChI | InChI=1S/C14H8N2Se/c15-9-10-5-7-11(8-6-10)14-16-12-3-1-2-4-13(12)17-14/h1-8H |
| InChIKey | INCFXECGEMFHKQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.19 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|