C12H20O — CID 135043142
(5E)-5-ethoxydeca-1,5,9-triene (PubChem CID 135043142) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (5E)-5-ethoxydeca-1,5,9-triene.
| Compound Name | (5E)-5-ethoxydeca-1,5,9-triene |
|---|---|
| PubChem CID | 135043142 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (5E)-5-ethoxydeca-1,5,9-triene |
| SMILES | C=CCC/C=C(\CCC=C)OCC |
| InChI | InChI=1S/C12H20O/c1-4-7-9-11-12(13-6-3)10-8-5-2/h4-5,11H,1-2,6-10H2,3H3/b12-11+ |
| InChIKey | AHDKFIFMNQSRFY-VAWYXSNFSA-N |
| XLogP | 3.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|