C10H13ClO3 — CID 135044397
2-chloro-6,6-dimethoxy-4,5-dimethylcyclohexa-2,4-dien-1-one (PubChem CID 135044397) has the molecular formula C10H13ClO3 and a molecular weight of 216.66 g/mol. Its IUPAC name is 2-chloro-6,6-dimethoxy-4,5-dimethylcyclohexa-2,4-dien-1-one.
| Compound Name | 2-chloro-6,6-dimethoxy-4,5-dimethylcyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 135044397 |
| Molecular Formula | C10H13ClO3 |
| Molecular Weight | 216.66 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 2-chloro-6,6-dimethoxy-4,5-dimethylcyclohexa-2,4-dien-1-one |
| SMILES | COC1(OC)C(=O)C(Cl)=CC(C)=C1C |
| InChI | InChI=1S/C10H13ClO3/c1-6-5-8(11)9(12)10(13-3,14-4)7(6)2/h5H,1-4H3 |
| InChIKey | QNXWNWFYQFMHIB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.66 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|