C10H12ClIO3 — CID 135044478
3-chloro-2-iodo-6,6-dimethoxy-4,5-dimethylcyclohexa-2,4-dien-1-one (PubChem CID 135044478) has the molecular formula C10H12ClIO3 and a molecular weight of 342.56 g/mol. Its IUPAC name is 3-chloro-2-iodo-6,6-dimethoxy-4,5-dimethylcyclohexa-2,4-dien-1-one.
| Compound Name | 3-chloro-2-iodo-6,6-dimethoxy-4,5-dimethylcyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 135044478 |
| Molecular Formula | C10H12ClIO3 |
| Molecular Weight | 342.56 g/mol |
| Exact Mass | 341.95 |
| IUPAC Name | 3-chloro-2-iodo-6,6-dimethoxy-4,5-dimethylcyclohexa-2,4-dien-1-one |
| SMILES | COC1(OC)C(=O)C(I)=C(Cl)C(C)=C1C |
| InChI | InChI=1S/C10H12ClIO3/c1-5-6(2)10(14-3,15-4)9(13)8(12)7(5)11/h1-4H3 |
| InChIKey | BWHGLOMKRIUNEK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.56 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|