About 3-(1,2-diazidoethyl)benzaldehyde
3-(1,2-diazidoethyl)benzaldehyde (PubChem CID 135044733) has the molecular formula C9H8N6O
and a molecular weight of 216.20 g/mol. Its IUPAC name is 3-(1,2-diazidoethyl)benzaldehyde.
Molecular Properties
| Compound Name | 3-(1,2-diazidoethyl)benzaldehyde |
| PubChem CID | 135044733 |
| Molecular Formula | C9H8N6O |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 3-(1,2-diazidoethyl)benzaldehyde |
| SMILES | [N-]=[N+]=NCC(N=[N+]=[N-])c1cccc(C=O)c1 |
| InChI | InChI=1S/C9H8N6O/c10-14-12-5-9(13-15-11)8-3-1-2-7(4-8)6-16/h1-4,6,9H,5H2 |
| InChIKey | XPFCRWAASWNHIN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 114.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,2-diazidoethyl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2-diazidoethyl)benzaldehyde?
The IUPAC name of 3-(1,2-diazidoethyl)benzaldehyde (CID 135044733) is 3-(1,2-diazidoethyl)benzaldehyde.
What is the SMILES notation for 3-(1,2-diazidoethyl)benzaldehyde?
The canonical SMILES for 3-(1,2-diazidoethyl)benzaldehyde is [N-]=[N+]=NCC(N=[N+]=[N-])c1cccc(C=O)c1.
What is the InChIKey of 3-(1,2-diazidoethyl)benzaldehyde?
The InChIKey is XPFCRWAASWNHIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N6O/c10-14-12-5-9(13-15-11)8-3-1-2-7(4-8)6-16/h1-4,6,9H,5H2.
What are the key properties of 3-(1,2-diazidoethyl)benzaldehyde?
3-(1,2-diazidoethyl)benzaldehyde has a molecular weight of 216.20 g/mol, XLogP of 3.16, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2-diazidoethyl)benzaldehyde is sourced from PubChem (CID 135044733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).