C13H6F2O2 — CID 135044827
1,8-difluoroxanthen-9-one (PubChem CID 135044827) has the molecular formula C13H6F2O2 and a molecular weight of 232.19 g/mol. Its IUPAC name is 1,8-difluoroxanthen-9-one.
| Compound Name | 1,8-difluoroxanthen-9-one |
|---|---|
| PubChem CID | 135044827 |
| Molecular Formula | C13H6F2O2 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 1,8-difluoroxanthen-9-one |
| SMILES | O=c1c2c(F)cccc2oc2cccc(F)c12 |
| InChI | InChI=1S/C13H6F2O2/c14-7-3-1-5-9-11(7)13(16)12-8(15)4-2-6-10(12)17-9/h1-6H |
| InChIKey | BEEGOVFVLXIRDF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|