C9H3F2IO2 — CID 141326158
2,5-difluoro-3-iodochromen-4-one (PubChem CID 141326158) has the molecular formula C9H3F2IO2 and a molecular weight of 308.02 g/mol. Its IUPAC name is 2,5-difluoro-3-iodochromen-4-one.
| Compound Name | 2,5-difluoro-3-iodochromen-4-one |
|---|---|
| PubChem CID | 141326158 |
| Molecular Formula | C9H3F2IO2 |
| Molecular Weight | 308.02 g/mol |
| Exact Mass | 307.91 |
| IUPAC Name | 2,5-difluoro-3-iodochromen-4-one |
| SMILES | O=c1c(I)c(F)oc2cccc(F)c12 |
| InChI | InChI=1S/C9H3F2IO2/c10-4-2-1-3-5-6(4)8(13)7(12)9(11)14-5/h1-3H |
| InChIKey | HAOIZJRBSQPIQE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.02 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|