C9H4F2INO — CID 170115692
4,8-difluoro-3-iodo-2H-isoquinolin-1-one (PubChem CID 170115692) has the molecular formula C9H4F2INO and a molecular weight of 307.04 g/mol. Its IUPAC name is 4,8-difluoro-3-iodo-2H-isoquinolin-1-one.
| Compound Name | 4,8-difluoro-3-iodo-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 170115692 |
| Molecular Formula | C9H4F2INO |
| Molecular Weight | 307.04 g/mol |
| Exact Mass | 306.93 |
| IUPAC Name | 4,8-difluoro-3-iodo-2H-isoquinolin-1-one |
| SMILES | O=c1[nH]c(I)c(F)c2cccc(F)c12 |
| InChI | InChI=1S/C9H4F2INO/c10-5-3-1-2-4-6(5)9(14)13-8(12)7(4)11/h1-3H,(H,13,14) |
| InChIKey | ZJHPHQVSTQVNOT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.04 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|