C11H12O3S — CID 135045038
5,6-dimethoxy-3-methyl-1-benzothiophen-4-ol (PubChem CID 135045038) has the molecular formula C11H12O3S and a molecular weight of 224.28 g/mol. Its IUPAC name is 5,6-dimethoxy-3-methyl-1-benzothiophen-4-ol.
| Compound Name | 5,6-dimethoxy-3-methyl-1-benzothiophen-4-ol |
|---|---|
| PubChem CID | 135045038 |
| Molecular Formula | C11H12O3S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 5,6-dimethoxy-3-methyl-1-benzothiophen-4-ol |
| SMILES | COc1cc2scc(C)c2c(O)c1OC |
| InChI | InChI=1S/C11H12O3S/c1-6-5-15-8-4-7(13-2)11(14-3)10(12)9(6)8/h4-5,12H,1-3H3 |
| InChIKey | GYKMSIYBBSLMAJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |