C9H13NO — CID 135045190
(8aR)-2-methylidene-1,5,6,7,8,8a-hexahydroindolizin-3-one (PubChem CID 135045190) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is (8aR)-2-methylidene-1,5,6,7,8,8a-hexahydroindolizin-3-one.
| Compound Name | (8aR)-2-methylidene-1,5,6,7,8,8a-hexahydroindolizin-3-one |
|---|---|
| PubChem CID | 135045190 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | (8aR)-2-methylidene-1,5,6,7,8,8a-hexahydroindolizin-3-one |
| SMILES | C=C1C[C@H]2CCCCN2C1=O |
| InChI | InChI=1S/C9H13NO/c1-7-6-8-4-2-3-5-10(8)9(7)11/h8H,1-6H2/t8-/m1/s1 |
| InChIKey | SVGYUAYXVOOSBH-MRVPVSSYSA-N |
| XLogP | 1.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|