C17H22O3 — CID 135045466
(4'bS)-4'b-methylspiro[1,3-dioxolane-2,7'-2,5,6,8,10,10a-hexahydro-1H-phenanthrene]-3'-one (PubChem CID 135045466) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is (4'bS)-4'b-methylspiro[1,3-dioxolane-2,7'-2,5,6,8,10,10a-hexahydro-1H-phenanthrene]-3'-one.
| Compound Name | (4'bS)-4'b-methylspiro[1,3-dioxolane-2,7'-2,5,6,8,10,10a-hexahydro-1H-phenanthrene]-3'-one |
|---|---|
| PubChem CID | 135045466 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (4'bS)-4'b-methylspiro[1,3-dioxolane-2,7'-2,5,6,8,10,10a-hexahydro-1H-phenanthrene]-3'-one |
| SMILES | C[C@]12CCC3(CC1=CCC1CCC(=O)C=C12)OCCO3 |
| InChI | InChI=1S/C17H22O3/c1-16-6-7-17(19-8-9-20-17)11-13(16)4-2-12-3-5-14(18)10-15(12)16/h4,10,12H,2-3,5-9,11H2,1H3/t12?,16-/m0/s1 |
| InChIKey | CXADPRNMXMUCIU-INSVYWFGSA-N |
| XLogP | 3.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|