C15H27BrO2 — CID 135048469
(2R,3S)-3-bromo-2-(2-methylnon-2-en-4-yloxy)oxane (PubChem CID 135048469) has the molecular formula C15H27BrO2 and a molecular weight of 319.28 g/mol. Its IUPAC name is (2R,3S)-3-bromo-2-(2-methylnon-2-en-4-yloxy)oxane.
| Compound Name | (2R,3S)-3-bromo-2-(2-methylnon-2-en-4-yloxy)oxane |
|---|---|
| PubChem CID | 135048469 |
| Molecular Formula | C15H27BrO2 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | (2R,3S)-3-bromo-2-(2-methylnon-2-en-4-yloxy)oxane |
| SMILES | CCCCCC(C=C(C)C)O[C@H]1OCCC[C@@H]1Br |
| InChI | InChI=1S/C15H27BrO2/c1-4-5-6-8-13(11-12(2)3)18-15-14(16)9-7-10-17-15/h11,13-15H,4-10H2,1-3H3/t13?,14-,15+/m0/s1 |
| InChIKey | LCPDWUIBQUJVQZ-NOYMGPGASA-N |
| XLogP | 4.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|