C15H25BrO2 — CID 14039068
2-[(2E,6E)-8-bromo-3,7-dimethylocta-2,6-dienoxy]oxane (PubChem CID 14039068) has the molecular formula C15H25BrO2 and a molecular weight of 317.27 g/mol. Its IUPAC name is 2-[(2E,6E)-8-bromo-3,7-dimethylocta-2,6-dienoxy]oxane.
| Compound Name | 2-[(2E,6E)-8-bromo-3,7-dimethylocta-2,6-dienoxy]oxane |
|---|---|
| PubChem CID | 14039068 |
| Molecular Formula | C15H25BrO2 |
| Molecular Weight | 317.27 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 2-[(2E,6E)-8-bromo-3,7-dimethylocta-2,6-dienoxy]oxane |
| SMILES | C/C(=C\CC/C(C)=C/COC1CCCCO1)CBr |
| InChI | InChI=1S/C15H25BrO2/c1-13(6-5-7-14(2)12-16)9-11-18-15-8-3-4-10-17-15/h7,9,15H,3-6,8,10-12H2,1-2H3/b13-9+,14-7+ |
| InChIKey | NMLMIXBUTCGUEG-BTLVJFLNSA-N |
| XLogP | 4.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.27 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|