C23H43BBrLiO — CID 135048886
lithium [(Z)-1-bromohex-1-enyl]-(2,3-dimethylbutan-2-yl)-oct-1-ynyl-propan-2-yloxyboranuide (PubChem CID 135048886) has the molecular formula C23H43BBrLiO and a molecular weight of 433.25 g/mol. Its IUPAC name is lithium [(Z)-1-bromohex-1-enyl]-(2,3-dimethylbutan-2-yl)-oct-1-ynyl-propan-2-yloxyboranuide.
| Compound Name | lithium [(Z)-1-bromohex-1-enyl]-(2,3-dimethylbutan-2-yl)-oct-1-ynyl-propan-2-yloxyboranuide |
|---|---|
| PubChem CID | 135048886 |
| Molecular Formula | C23H43BBrLiO |
| Molecular Weight | 433.25 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | lithium [(Z)-1-bromohex-1-enyl]-(2,3-dimethylbutan-2-yl)-oct-1-ynyl-propan-2-yloxyboranuide |
| SMILES | CCCC/C=C(\Br)[B-](C#CCCCCCC)(OC(C)C)C(C)(C)C(C)C.[Li+] |
| InChI | InChI=1S/C23H43BBrO.Li/c1-9-11-13-14-15-17-19-24(26-21(5)6,23(7,8)20(3)4)22(25)18-16-12-10-2;/h18,20-21H,9-16H2,1-8H3;/q-1;+1/b22-18-; |
| InChIKey | CURFFCWPASIMKL-QNCGTCMPSA-N |
| XLogP | 5.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.25 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|