C24H45BO — CID 13346326
2,3-dimethylbutan-2-yl-[(E)-pentadec-8-en-6-yn-8-yl]-propan-2-yloxyborane (PubChem CID 13346326) has the molecular formula C24H45BO and a molecular weight of 360.44 g/mol. Its IUPAC name is 2,3-dimethylbutan-2-yl-[(E)-pentadec-8-en-6-yn-8-yl]-propan-2-yloxyborane.
| Compound Name | 2,3-dimethylbutan-2-yl-[(E)-pentadec-8-en-6-yn-8-yl]-propan-2-yloxyborane |
|---|---|
| PubChem CID | 13346326 |
| Molecular Formula | C24H45BO |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.36 |
| IUPAC Name | 2,3-dimethylbutan-2-yl-[(E)-pentadec-8-en-6-yn-8-yl]-propan-2-yloxyborane |
| SMILES | CCCCCC#C/C(=C/CCCCCC)B(OC(C)C)C(C)(C)C(C)C |
| InChI | InChI=1S/C24H45BO/c1-9-11-13-15-17-19-23(20-18-16-14-12-10-2)25(26-22(5)6)24(7,8)21(3)4/h19,21-22H,9-17H2,1-8H3/b23-19- |
| InChIKey | WOKYTUHYXXHLRA-NMWGTECJSA-N |
| XLogP | 7.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|