C21H36N2OSi — CID 135049524
(E,2R)-2-[tert-butyl(dimethyl)silyl]-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1-phenylpropan-1-imine (PubChem CID 135049524) has the molecular formula C21H36N2OSi and a molecular weight of 360.62 g/mol. Its IUPAC name is (E,2R)-2-[tert-butyl(dimethyl)silyl]-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1-phenylpropan-1-imine.
| Compound Name | (E,2R)-2-[tert-butyl(dimethyl)silyl]-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1-phenylpropan-1-imine |
|---|---|
| PubChem CID | 135049524 |
| Molecular Formula | C21H36N2OSi |
| Molecular Weight | 360.62 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | (E,2R)-2-[tert-butyl(dimethyl)silyl]-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1-phenylpropan-1-imine |
| SMILES | COC[C@@H]1CCCN1/N=C(\c1ccccc1)[C@@H](C)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H36N2OSi/c1-17(25(6,7)21(2,3)4)20(18-12-9-8-10-13-18)22-23-15-11-14-19(23)16-24-5/h8-10,12-13,17,19H,11,14-16H2,1-7H3/b22-20-/t17-,19+/m1/s1 |
| InChIKey | AGAJWXZPALCDOU-AIHYEWLFSA-N |
| XLogP | 5.40 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.62 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|