About 3-[tert-butyl(dimethyl)silyl]-1-trimethylsilyldeca-1,5-diyn-4-ol
3-[tert-butyl(dimethyl)silyl]-1-trimethylsilyldeca-1,5-diyn-4-ol (PubChem CID 135049710) has the molecular formula C19H36OSi2
and a molecular weight of 336.67 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]-1-trimethylsilyldeca-1,5-diyn-4-ol.
Molecular Properties
| Compound Name | 3-[tert-butyl(dimethyl)silyl]-1-trimethylsilyldeca-1,5-diyn-4-ol |
| PubChem CID | 135049710 |
| Molecular Formula | C19H36OSi2 |
| Molecular Weight | 336.67 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]-1-trimethylsilyldeca-1,5-diyn-4-ol |
| SMILES | CCCCC#CC(O)C(C#C[Si](C)(C)C)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36OSi2/c1-10-11-12-13-14-17(20)18(15-16-21(5,6)7)22(8,9)19(2,3)4/h17-18,20H,10-12H2,1-9H3 |
| InChIKey | AKDIOHJUZNXTIV-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.67 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[tert-butyl(dimethyl)silyl]-1-trimethylsilyldeca-1,5-diyn-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[tert-butyl(dimethyl)silyl]-1-trimethylsilyldeca-1,5-diyn-4-ol?
The IUPAC name of 3-[tert-butyl(dimethyl)silyl]-1-trimethylsilyldeca-1,5-diyn-4-ol (CID 135049710) is 3-[tert-butyl(dimethyl)silyl]-1-trimethylsilyldeca-1,5-diyn-4-ol.
What is the SMILES notation for 3-[tert-butyl(dimethyl)silyl]-1-trimethylsilyldeca-1,5-diyn-4-ol?
The canonical SMILES for 3-[tert-butyl(dimethyl)silyl]-1-trimethylsilyldeca-1,5-diyn-4-ol is CCCCC#CC(O)C(C#C[Si](C)(C)C)[Si](C)(C)C(C)(C)C.
What is the InChIKey of 3-[tert-butyl(dimethyl)silyl]-1-trimethylsilyldeca-1,5-diyn-4-ol?
The InChIKey is AKDIOHJUZNXTIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36OSi2/c1-10-11-12-13-14-17(20)18(15-16-21(5,6)7)22(8,9)19(2,3)4/h17-18,20H,10-12H2,1-9H3.
What are the key properties of 3-[tert-butyl(dimethyl)silyl]-1-trimethylsilyldeca-1,5-diyn-4-ol?
3-[tert-butyl(dimethyl)silyl]-1-trimethylsilyldeca-1,5-diyn-4-ol has a molecular weight of 336.67 g/mol, XLogP of 5.30, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[tert-butyl(dimethyl)silyl]-1-trimethylsilyldeca-1,5-diyn-4-ol is sourced from PubChem (CID 135049710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).