C19H36OSi2 — CID 135049710
3-[tert-butyl(dimethyl)silyl]-1-trimethylsilyldeca-1,5-diyn-4-ol (PubChem CID 135049710) has the molecular formula C19H36OSi2 and a molecular weight of 336.67 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]-1-trimethylsilyldeca-1,5-diyn-4-ol.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]-1-trimethylsilyldeca-1,5-diyn-4-ol |
|---|---|
| PubChem CID | 135049710 |
| Molecular Formula | C19H36OSi2 |
| Molecular Weight | 336.67 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]-1-trimethylsilyldeca-1,5-diyn-4-ol |
| SMILES | CCCCC#CC(O)C(C#C[Si](C)(C)C)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36OSi2/c1-10-11-12-13-14-17(20)18(15-16-21(5,6)7)22(8,9)19(2,3)4/h17-18,20H,10-12H2,1-9H3 |
| InChIKey | AKDIOHJUZNXTIV-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.67 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|