C27H34O3S — CID 135050585
[(5S,10S,13S)-13-methyl-17-phenylsulfanylcarbonyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 135050585) has the molecular formula C27H34O3S and a molecular weight of 438.63 g/mol. Its IUPAC name is [(5S,10S,13S)-13-methyl-17-phenylsulfanylcarbonyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(5S,10S,13S)-13-methyl-17-phenylsulfanylcarbonyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 135050585 |
| Molecular Formula | C27H34O3S |
| Molecular Weight | 438.63 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | [(5S,10S,13S)-13-methyl-17-phenylsulfanylcarbonyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1CC[C@@H]2C3CC[C@]4(C)C(C(=O)Sc5ccccc5)=CCC4C3CC[C@H]2C1 |
| InChI | InChI=1S/C27H34O3S/c1-17(28)30-19-9-11-21-18(16-19)8-10-23-22(21)14-15-27(2)24(23)12-13-25(27)26(29)31-20-6-4-3-5-7-20/h3-7,13,18-19,21-24H,8-12,14-16H2,1-2H3/t18-,19?,21-,22?,23?,24?,27-/m0/s1 |
| InChIKey | XSEDMPIBBPRQCD-HXFTWQHWSA-N |
| XLogP | 6.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.63 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|