C22H30O2 — CID 22800013
[(3S,5R,8R,9R,10S,13S,14S)-17-ethynyl-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 22800013) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is [(3S,5R,8R,9R,10S,13S,14S)-17-ethynyl-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,5R,8R,9R,10S,13S,14S)-17-ethynyl-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 22800013 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | [(3S,5R,8R,9R,10S,13S,14S)-17-ethynyl-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | C#CC1=CC[C@H]2[C@@H]3CC[C@@H]4C[C@@H](OC(C)=O)CC[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C22H30O2/c1-4-16-6-10-21-20-8-5-15-13-17(24-14(2)23)7-9-18(15)19(20)11-12-22(16,21)3/h1,6,15,17-21H,5,7-13H2,2-3H3/t15-,17+,18+,19-,20-,21+,22-/m1/s1 |
| InChIKey | WXIPMTXZYZRISB-NMLDVCBUSA-N |
| XLogP | 4.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|