C15H33AlOSi — CID 135050725
tert-butyl-[(E,2S)-5-dimethylalumanyl-2,4-dimethylpent-4-enoxy]-dimethylsilane (PubChem CID 135050725) has the molecular formula C15H33AlOSi and a molecular weight of 284.50 g/mol. Its IUPAC name is tert-butyl-[(E,2S)-5-dimethylalumanyl-2,4-dimethylpent-4-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E,2S)-5-dimethylalumanyl-2,4-dimethylpent-4-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 135050725 |
| Molecular Formula | C15H33AlOSi |
| Molecular Weight | 284.50 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | tert-butyl-[(E,2S)-5-dimethylalumanyl-2,4-dimethylpent-4-enoxy]-dimethylsilane |
| SMILES | C/C(=C\[Al](C)C)C[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H27OSi.2CH3.Al/c1-11(2)9-12(3)10-14-15(7,8)13(4,5)6;;;/h1,12H,9-10H2,2-8H3;2*1H3;/t12-;;;/m0.../s1 |
| InChIKey | NXRHVYOWNZLXLQ-JNQXMBDASA-N |
| XLogP | 5.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.50 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|