About 3-methyl-4-phenyl-1,3-oxazol-3-ium-5-ol
3-methyl-4-phenyl-1,3-oxazol-3-ium-5-ol (PubChem CID 135052199) has the molecular formula C10H10NO2+
and a molecular weight of 176.19 g/mol. Its IUPAC name is 3-methyl-4-phenyl-1,3-oxazol-3-ium-5-ol.
Molecular Properties
| Compound Name | 3-methyl-4-phenyl-1,3-oxazol-3-ium-5-ol |
| PubChem CID | 135052199 |
| Molecular Formula | C10H10NO2+ |
| Molecular Weight | 176.19 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 3-methyl-4-phenyl-1,3-oxazol-3-ium-5-ol |
| SMILES | C[n+]1coc(O)c1-c1ccccc1 |
| InChI | InChI=1S/C10H9NO2/c1-11-7-13-10(12)9(11)8-5-3-2-4-6-8/h2-7H,1H3/p+1 |
| InChIKey | XKSOJAJRWAJZRD-UHFFFAOYSA-O |
| XLogP | 1.48 |
| TPSA | 37.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.19 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-4-phenyl-1,3-oxazol-3-ium-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-phenyl-1,3-oxazol-3-ium-5-ol?
The IUPAC name of 3-methyl-4-phenyl-1,3-oxazol-3-ium-5-ol (CID 135052199) is 3-methyl-4-phenyl-1,3-oxazol-3-ium-5-ol.
What is the SMILES notation for 3-methyl-4-phenyl-1,3-oxazol-3-ium-5-ol?
The canonical SMILES for 3-methyl-4-phenyl-1,3-oxazol-3-ium-5-ol is C[n+]1coc(O)c1-c1ccccc1.
What is the InChIKey of 3-methyl-4-phenyl-1,3-oxazol-3-ium-5-ol?
The InChIKey is XKSOJAJRWAJZRD-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H9NO2/c1-11-7-13-10(12)9(11)8-5-3-2-4-6-8/h2-7H,1H3/p+1.
What are the key properties of 3-methyl-4-phenyl-1,3-oxazol-3-ium-5-ol?
3-methyl-4-phenyl-1,3-oxazol-3-ium-5-ol has a molecular weight of 176.19 g/mol, XLogP of 1.48, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-phenyl-1,3-oxazol-3-ium-5-ol is sourced from PubChem (CID 135052199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).