C11H13N3S — CID 135052689
N,N-dimethyl-6-phenyl-6H-1,3,4-thiadiazin-2-amine (PubChem CID 135052689) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is N,N-dimethyl-6-phenyl-6H-1,3,4-thiadiazin-2-amine.
| Compound Name | N,N-dimethyl-6-phenyl-6H-1,3,4-thiadiazin-2-amine |
|---|---|
| PubChem CID | 135052689 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | N,N-dimethyl-6-phenyl-6H-1,3,4-thiadiazin-2-amine |
| SMILES | CN(C)C1=NN=CC(c2ccccc2)S1 |
| InChI | InChI=1S/C11H13N3S/c1-14(2)11-13-12-8-10(15-11)9-6-4-3-5-7-9/h3-8,10H,1-2H3 |
| InChIKey | HGXHMPUEKFNWBY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |