About 1-O-ethyl 4-O-methyl (E)-2-(4-nitroanilino)but-2-enedioate
1-O-ethyl 4-O-methyl (E)-2-(4-nitroanilino)but-2-enedioate (PubChem CID 135053248) has the molecular formula C13H14N2O6
and a molecular weight of 294.26 g/mol. Its IUPAC name is 1-O-ethyl 4-O-methyl (E)-2-(4-nitroanilino)but-2-enedioate.
Molecular Properties
| Compound Name | 1-O-ethyl 4-O-methyl (E)-2-(4-nitroanilino)but-2-enedioate |
| PubChem CID | 135053248 |
| Molecular Formula | C13H14N2O6 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 1-O-ethyl 4-O-methyl (E)-2-(4-nitroanilino)but-2-enedioate |
| SMILES | CCOC(=O)/C(=C\C(=O)OC)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H14N2O6/c1-3-21-13(17)11(8-12(16)20-2)14-9-4-6-10(7-5-9)15(18)19/h4-8,14H,3H2,1-2H3/b11-8+ |
| InChIKey | XVIRWYKRWQFMHP-DHZHZOJOSA-N |
| XLogP | 1.63 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 4-O-methyl (E)-2-(4-nitroanilino)but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 4-O-methyl (E)-2-(4-nitroanilino)but-2-enedioate?
The IUPAC name of 1-O-ethyl 4-O-methyl (E)-2-(4-nitroanilino)but-2-enedioate (CID 135053248) is 1-O-ethyl 4-O-methyl (E)-2-(4-nitroanilino)but-2-enedioate.
What is the SMILES notation for 1-O-ethyl 4-O-methyl (E)-2-(4-nitroanilino)but-2-enedioate?
The canonical SMILES for 1-O-ethyl 4-O-methyl (E)-2-(4-nitroanilino)but-2-enedioate is CCOC(=O)/C(=C\C(=O)OC)Nc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 1-O-ethyl 4-O-methyl (E)-2-(4-nitroanilino)but-2-enedioate?
The InChIKey is XVIRWYKRWQFMHP-DHZHZOJOSA-N. The full InChI is InChI=1S/C13H14N2O6/c1-3-21-13(17)11(8-12(16)20-2)14-9-4-6-10(7-5-9)15(18)19/h4-8,14H,3H2,1-2H3/b11-8+.
What are the key properties of 1-O-ethyl 4-O-methyl (E)-2-(4-nitroanilino)but-2-enedioate?
1-O-ethyl 4-O-methyl (E)-2-(4-nitroanilino)but-2-enedioate has a molecular weight of 294.26 g/mol, XLogP of 1.63, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 4-O-methyl (E)-2-(4-nitroanilino)but-2-enedioate is sourced from PubChem (CID 135053248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).