C13H7F5N2O4 — CID 135053633
ethyl 3-nitro-4-(2,3,4,5,6-pentafluorophenyl)-1H-pyrrole-2-carboxylate (PubChem CID 135053633) has the molecular formula C13H7F5N2O4 and a molecular weight of 350.20 g/mol. Its IUPAC name is ethyl 3-nitro-4-(2,3,4,5,6-pentafluorophenyl)-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 3-nitro-4-(2,3,4,5,6-pentafluorophenyl)-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 135053633 |
| Molecular Formula | C13H7F5N2O4 |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | ethyl 3-nitro-4-(2,3,4,5,6-pentafluorophenyl)-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]cc(-c2c(F)c(F)c(F)c(F)c2F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H7F5N2O4/c1-2-24-13(21)11-12(20(22)23)4(3-19-11)5-6(14)8(16)10(18)9(17)7(5)15/h3,19H,2H2,1H3 |
| InChIKey | QPNAVSUYPZJKSW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|