C14H11F3N2O5 — CID 135008315
ethyl 4-nitro-3-[4-(trifluoromethoxy)phenyl]-1H-pyrrole-2-carboxylate (PubChem CID 135008315) has the molecular formula C14H11F3N2O5 and a molecular weight of 344.25 g/mol. Its IUPAC name is ethyl 4-nitro-3-[4-(trifluoromethoxy)phenyl]-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-nitro-3-[4-(trifluoromethoxy)phenyl]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 135008315 |
| Molecular Formula | C14H11F3N2O5 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | ethyl 4-nitro-3-[4-(trifluoromethoxy)phenyl]-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]cc([N+](=O)[O-])c1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H11F3N2O5/c1-2-23-13(20)12-11(10(7-18-12)19(21)22)8-3-5-9(6-4-8)24-14(15,16)17/h3-7,18H,2H2,1H3 |
| InChIKey | VAJJRHRTDTYNFM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|