C22H30FNO3 — CID 155367687
ethyl 3-fluoro-4-(4-nonoxyphenyl)-1H-pyrrole-2-carboxylate (PubChem CID 155367687) has the molecular formula C22H30FNO3 and a molecular weight of 375.48 g/mol. Its IUPAC name is ethyl 3-fluoro-4-(4-nonoxyphenyl)-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 3-fluoro-4-(4-nonoxyphenyl)-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 155367687 |
| Molecular Formula | C22H30FNO3 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | ethyl 3-fluoro-4-(4-nonoxyphenyl)-1H-pyrrole-2-carboxylate |
| SMILES | CCCCCCCCCOc1ccc(-c2c[nH]c(C(=O)OCC)c2F)cc1 |
| InChI | InChI=1S/C22H30FNO3/c1-3-5-6-7-8-9-10-15-27-18-13-11-17(12-14-18)19-16-24-21(20(19)23)22(25)26-4-2/h11-14,16,24H,3-10,15H2,1-2H3 |
| InChIKey | BBFBZCJNNWILEI-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|